C12H25NO — CID 59421231
2,4,4,6,6,8-hexamethyl-1,5-oxazocane (PubChem CID 59421231) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is 2,4,4,6,6,8-hexamethyl-1,5-oxazocane.
| Compound Name | 2,4,4,6,6,8-hexamethyl-1,5-oxazocane |
|---|---|
| PubChem CID | 59421231 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2,4,4,6,6,8-hexamethyl-1,5-oxazocane |
| SMILES | CC1CC(C)(C)NC(C)(C)CC(C)O1 |
| InChI | InChI=1S/C12H25NO/c1-9-7-11(3,4)13-12(5,6)8-10(2)14-9/h9-10,13H,7-8H2,1-6H3 |
| InChIKey | QRBDLLDTMFBDSQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |