C27H32N4O2 — CID 59421319
2-(cyclohexylamino)-N-(3-methoxypropyl)-4-(4-phenylphenyl)pyrimidine-5-carboxamide (PubChem CID 59421319) has the molecular formula C27H32N4O2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N-(3-methoxypropyl)-4-(4-phenylphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N-(3-methoxypropyl)-4-(4-phenylphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59421319 |
| Molecular Formula | C27H32N4O2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-(cyclohexylamino)-N-(3-methoxypropyl)-4-(4-phenylphenyl)pyrimidine-5-carboxamide |
| SMILES | COCCCNC(=O)c1cnc(NC2CCCCC2)nc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C27H32N4O2/c1-33-18-8-17-28-26(32)24-19-29-27(30-23-11-6-3-7-12-23)31-25(24)22-15-13-21(14-16-22)20-9-4-2-5-10-20/h2,4-5,9-10,13-16,19,23H,3,6-8,11-12,17-18H2,1H3,(H,28,32)(H,29,30,31) |
| InChIKey | KTPXEASEXLMAMJ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|