About 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one
4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 59421461) has the molecular formula C10H11N3O
and a molecular weight of 189.22 g/mol. Its IUPAC name is 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| PubChem CID | 59421461 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCCc1ncnc2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C10H11N3O/c1-2-3-8-7-4-5-9(14)13-10(7)12-6-11-8/h4-6H,2-3H2,1H3,(H,11,12,13,14) |
| InChIKey | IWDFWSIYIAJFAT-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The IUPAC name of 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one (CID 59421461) is 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one.
What is the SMILES notation for 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The canonical SMILES for 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one is CCCc1ncnc2[nH]c(=O)ccc12.
What is the InChIKey of 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one?
The InChIKey is IWDFWSIYIAJFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O/c1-2-3-8-7-4-5-9(14)13-10(7)12-6-11-8/h4-6H,2-3H2,1H3,(H,11,12,13,14).
What are the key properties of 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one?
4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one has a molecular weight of 189.22 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propyl-8H-pyrido[2,3-d]pyrimidin-7-one is sourced from PubChem (CID 59421461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).