About 1-methylpyrazolo[3,4-b]pyrazine
1-methylpyrazolo[3,4-b]pyrazine (PubChem CID 59421494) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1-methylpyrazolo[3,4-b]pyrazine.
Molecular Properties
| Compound Name | 1-methylpyrazolo[3,4-b]pyrazine |
| PubChem CID | 59421494 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1-methylpyrazolo[3,4-b]pyrazine |
| SMILES | Cn1ncc2nccnc21 |
| InChI | InChI=1S/C6H6N4/c1-10-6-5(4-9-10)7-2-3-8-6/h2-4H,1H3 |
| InChIKey | RRRIVLVAFKDWCH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpyrazolo[3,4-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazolo[3,4-b]pyrazine?
The IUPAC name of 1-methylpyrazolo[3,4-b]pyrazine (CID 59421494) is 1-methylpyrazolo[3,4-b]pyrazine.
What is the SMILES notation for 1-methylpyrazolo[3,4-b]pyrazine?
The canonical SMILES for 1-methylpyrazolo[3,4-b]pyrazine is Cn1ncc2nccnc21.
What is the InChIKey of 1-methylpyrazolo[3,4-b]pyrazine?
The InChIKey is RRRIVLVAFKDWCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-10-6-5(4-9-10)7-2-3-8-6/h2-4H,1H3.
What are the key properties of 1-methylpyrazolo[3,4-b]pyrazine?
1-methylpyrazolo[3,4-b]pyrazine has a molecular weight of 134.14 g/mol, XLogP of 0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazolo[3,4-b]pyrazine is sourced from PubChem (CID 59421494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).