About ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium
ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium (PubChem CID 59421519) has the molecular formula C11H13N3OY-2
and a molecular weight of 292.15 g/mol. Its IUPAC name is ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium.
Molecular Properties
| Compound Name | ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium |
| PubChem CID | 59421519 |
| Molecular Formula | C11H13N3OY-2 |
| Molecular Weight | 292.15 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium |
| SMILES | [CH2-]C.[CH2-]Cc1ncnc2[nH]c(=O)ccc12.[Y] |
| InChI | InChI=1S/C9H8N3O.C2H5.Y/c1-2-7-6-3-4-8(13)12-9(6)11-5-10-7;1-2;/h3-5H,1-2H2,(H,10,11,12,13);1H2,2H3;/q2*-1; |
| InChIKey | LOYJMRDYATYYRA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium?
The IUPAC name of ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium (CID 59421519) is ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium.
What is the SMILES notation for ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium?
The canonical SMILES for ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium is [CH2-]C.[CH2-]Cc1ncnc2[nH]c(=O)ccc12.[Y].
What is the InChIKey of ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium?
The InChIKey is LOYJMRDYATYYRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N3O.C2H5.Y/c1-2-7-6-3-4-8(13)12-9(6)11-5-10-7;1-2;/h3-5H,1-2H2,(H,10,11,12,13);1H2,2H3;/q2*-1;.
What are the key properties of ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium?
ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium has a molecular weight of 292.15 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-ethyl-8H-pyrido[2,3-d]pyrimidin-7-one;yttrium is sourced from PubChem (CID 59421519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).