About VX 509
VX 509 (PubChem CID 59422203) has the molecular formula C18H19F3N6O
and a molecular weight of 392.40 g/mol. Its IUPAC name is (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide.
Molecular Properties
| Compound Name | VX 509 |
| PubChem CID | 59422203 |
| Molecular Formula | C18H19F3N6O |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CC[C@](C)(C(=O)NCC(F)(F)F)NC1=NC(=NC=C1)C2=CNC3=C2C=CC=N3 |
| InChI | InChI=1S/C18H19F3N6O/c1-3-17(2,16(28)25-10-18(19,20)21)27-13-6-8-23-15(26-13)12-9-24-14-11(12)5-4-7-22-14/h4-9H,3,10H2,1-2H3,(H,22,24)(H,25,28)(H,23,26,27)/t17-/m1/s1 |
| InChIKey | ASUGUQWIHMTFJL-QGZVFWFLSA-N |
| XLogP | 3.10 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | 548 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze VX 509 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of VX 509?
The IUPAC name of VX 509 (CID 59422203) is (2R)-2-methyl-2-[[2-(1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]-N-(2,2,2-trifluoroethyl)butanamide.
What is the SMILES notation for VX 509?
The canonical SMILES for VX 509 is CC[C@](C)(C(=O)NCC(F)(F)F)NC1=NC(=NC=C1)C2=CNC3=C2C=CC=N3.
What is the InChIKey of VX 509?
The InChIKey is ASUGUQWIHMTFJL-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H19F3N6O/c1-3-17(2,16(28)25-10-18(19,20)21)27-13-6-8-23-15(26-13)12-9-24-14-11(12)5-4-7-22-14/h4-9H,3,10H2,1-2H3,(H,22,24)(H,25,28)(H,23,26,27)/t17-/m1/s1.
What are the key properties of VX 509?
VX 509 has a molecular weight of 392.40 g/mol, XLogP of 3.10, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for VX 509 is sourced from PubChem (CID 59422203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).