C18H19F6NO2 — CID 59422440
6-[2,3-dimethyl-4,6-bis(trifluoromethyl)indol-3-yl]hexanoic acid (PubChem CID 59422440) has the molecular formula C18H19F6NO2 and a molecular weight of 395.34 g/mol. Its IUPAC name is 6-[2,3-dimethyl-4,6-bis(trifluoromethyl)indol-3-yl]hexanoic acid.
| Compound Name | 6-[2,3-dimethyl-4,6-bis(trifluoromethyl)indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 59422440 |
| Molecular Formula | C18H19F6NO2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 6-[2,3-dimethyl-4,6-bis(trifluoromethyl)indol-3-yl]hexanoic acid |
| SMILES | CC1=Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2C1(C)CCCCCC(=O)O |
| InChI | InChI=1S/C18H19F6NO2/c1-10-16(2,7-5-3-4-6-14(26)27)15-12(18(22,23)24)8-11(17(19,20)21)9-13(15)25-10/h8-9H,3-7H2,1-2H3,(H,26,27) |
| InChIKey | VZVOUYKDTMZCOO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|