C15H11F7N2 — CID 59422452
1,3,4,5,6,7,8-heptafluoro-N-[(E)-3-methylbutan-2-ylideneamino]naphthalen-2-amine (PubChem CID 59422452) has the molecular formula C15H11F7N2 and a molecular weight of 352.25 g/mol. Its IUPAC name is 1,3,4,5,6,7,8-heptafluoro-N-[(E)-3-methylbutan-2-ylideneamino]naphthalen-2-amine.
| Compound Name | 1,3,4,5,6,7,8-heptafluoro-N-[(E)-3-methylbutan-2-ylideneamino]naphthalen-2-amine |
|---|---|
| PubChem CID | 59422452 |
| Molecular Formula | C15H11F7N2 |
| Molecular Weight | 352.25 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 1,3,4,5,6,7,8-heptafluoro-N-[(E)-3-methylbutan-2-ylideneamino]naphthalen-2-amine |
| SMILES | C/C(=N\Nc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)C(C)C |
| InChI | InChI=1S/C15H11F7N2/c1-4(2)5(3)23-24-15-11(19)7-6(10(18)14(15)22)8(16)12(20)13(21)9(7)17/h4,24H,1-3H3/b23-5+ |
| InChIKey | MFLXBEDPAYUQGQ-MUDSWDHVSA-N |
| XLogP | 5.26 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.25 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|