C18H15FO8 — CID 59422632
5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 59422632) has the molecular formula C18H15FO8 and a molecular weight of 378.31 g/mol. Its IUPAC name is 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 59422632 |
| Molecular Formula | C18H15FO8 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 5-[4-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)-3-fluorocyclohexa-2,5-dien-1-ylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=c2ccc(=C3C(=O)OC(C)(C)OC3=O)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H15FO8/c1-17(2)24-13(20)11(14(21)25-17)8-5-6-9(10(19)7-8)12-15(22)26-18(3,4)27-16(12)23/h5-7H,1-4H3 |
| InChIKey | YTSZVHKKLTZMEZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |