C34H46N2O3Si — CID 59423729
(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-N-(6-phenoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine (PubChem CID 59423729) has the molecular formula C34H46N2O3Si and a molecular weight of 558.84 g/mol. Its IUPAC name is (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-N-(6-phenoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine.
| Compound Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-N-(6-phenoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine |
|---|---|
| PubChem CID | 59423729 |
| Molecular Formula | C34H46N2O3Si |
| Molecular Weight | 558.84 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-1-N-(6-phenoxy-3-prop-2-enoxy-2,3-dihydro-1H-inden-1-yl)-4-phenylbutane-1,3-diamine |
| SMILES | C=CCOC1CC(NC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)Cc2ccccc2)c2cc(Oc3ccccc3)ccc21 |
| InChI | InChI=1S/C34H46N2O3Si/c1-7-20-37-32-23-31(29-22-27(18-19-28(29)32)38-26-16-12-9-13-17-26)36-24-33(39-40(5,6)34(2,3)4)30(35)21-25-14-10-8-11-15-25/h7-19,22,30-33,36H,1,20-21,23-24,35H2,2-6H3/t30-,31?,32?,33+/m0/s1 |
| InChIKey | FWWWXSGPXFNYAV-SWVHUNMDSA-N |
| XLogP | 7.72 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.84 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|