C10H19N — CID 59424109
(5E)-5-propan-2-yl-1,2,3,4,7,8-hexahydroazocine (PubChem CID 59424109) has the molecular formula C10H19N and a molecular weight of 153.27 g/mol. Its IUPAC name is (5E)-5-propan-2-yl-1,2,3,4,7,8-hexahydroazocine.
| Compound Name | (5E)-5-propan-2-yl-1,2,3,4,7,8-hexahydroazocine |
|---|---|
| PubChem CID | 59424109 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (5E)-5-propan-2-yl-1,2,3,4,7,8-hexahydroazocine |
| SMILES | CC(C)/C1=C/CCNCCC1 |
| InChI | InChI=1S/C10H19N/c1-9(2)10-5-3-7-11-8-4-6-10/h5,9,11H,3-4,6-8H2,1-2H3/b10-5+ |
| InChIKey | HWTNZSIDJZOTGA-BJMVGYQFSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|