C23H19ClF2N4O4 — CID 59424262
4-N-(3-chloro-4-fluorophenyl)-4-N-[(3,4-dimethoxyphenyl)methyl]-7-fluoro-6-N-hydroperoxyquinazoline-4,6-diamine (PubChem CID 59424262) has the molecular formula C23H19ClF2N4O4 and a molecular weight of 488.88 g/mol. Its IUPAC name is 4-N-(3-chloro-4-fluorophenyl)-4-N-[(3,4-dimethoxyphenyl)methyl]-7-fluoro-6-N-hydroperoxyquinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-fluorophenyl)-4-N-[(3,4-dimethoxyphenyl)methyl]-7-fluoro-6-N-hydroperoxyquinazoline-4,6-diamine |
|---|---|
| PubChem CID | 59424262 |
| Molecular Formula | C23H19ClF2N4O4 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 4-N-(3-chloro-4-fluorophenyl)-4-N-[(3,4-dimethoxyphenyl)methyl]-7-fluoro-6-N-hydroperoxyquinazoline-4,6-diamine |
| SMILES | COc1ccc(CN(c2ccc(F)c(Cl)c2)c2ncnc3cc(F)c(NOO)cc23)cc1OC |
| InChI | InChI=1S/C23H19ClF2N4O4/c1-32-21-6-3-13(7-22(21)33-2)11-30(14-4-5-17(25)16(24)8-14)23-15-9-20(29-34-31)18(26)10-19(15)27-12-28-23/h3-10,12,29,31H,11H2,1-2H3 |
| InChIKey | JQWCJBJWXRHFHH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|