About 1-piperidin-4-yl-3,6-dihydro-2H-pyridine
1-piperidin-4-yl-3,6-dihydro-2H-pyridine (PubChem CID 59424381) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-piperidin-4-yl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-piperidin-4-yl-3,6-dihydro-2H-pyridine |
| PubChem CID | 59424381 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-piperidin-4-yl-3,6-dihydro-2H-pyridine |
| SMILES | C1=CCN(C2CCNCC2)CC1 |
| InChI | InChI=1S/C10H18N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h1-2,10-11H,3-9H2 |
| InChIKey | SNYSEPJHWVJOGF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-piperidin-4-yl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-4-yl-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-piperidin-4-yl-3,6-dihydro-2H-pyridine (CID 59424381) is 1-piperidin-4-yl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-piperidin-4-yl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-piperidin-4-yl-3,6-dihydro-2H-pyridine is C1=CCN(C2CCNCC2)CC1.
What is the InChIKey of 1-piperidin-4-yl-3,6-dihydro-2H-pyridine?
The InChIKey is SNYSEPJHWVJOGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h1-2,10-11H,3-9H2.
What are the key properties of 1-piperidin-4-yl-3,6-dihydro-2H-pyridine?
1-piperidin-4-yl-3,6-dihydro-2H-pyridine has a molecular weight of 166.27 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-4-yl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 59424381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).