About 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride
4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride (PubChem CID 59424546) has the molecular formula C7H2Cl2N2OS
and a molecular weight of 233.08 g/mol. Its IUPAC name is 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride.
Molecular Properties
| Compound Name | 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride |
| PubChem CID | 59424546 |
| Molecular Formula | C7H2Cl2N2OS |
| Molecular Weight | 233.08 g/mol |
| Exact Mass | 231.93 |
| IUPAC Name | 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride |
| SMILES | O=C(Cl)c1cc2ncnc(Cl)c2s1 |
| InChI | InChI=1S/C7H2Cl2N2OS/c8-6-5-3(10-2-11-6)1-4(13-5)7(9)12/h1-2H |
| InChIKey | VLKFTMFLJYWQNK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride?
The IUPAC name of 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride (CID 59424546) is 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride.
What is the SMILES notation for 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride?
The canonical SMILES for 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride is O=C(Cl)c1cc2ncnc(Cl)c2s1.
What is the InChIKey of 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride?
The InChIKey is VLKFTMFLJYWQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2Cl2N2OS/c8-6-5-3(10-2-11-6)1-4(13-5)7(9)12/h1-2H.
What are the key properties of 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride?
4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride has a molecular weight of 233.08 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorothieno[3,2-d]pyrimidine-6-carbonyl chloride is sourced from PubChem (CID 59424546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).