C15H19NO6S2 — CID 59424861
(2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid (PubChem CID 59424861) has the molecular formula C15H19NO6S2 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid.
| Compound Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 59424861 |
| Molecular Formula | C15H19NO6S2 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | (2R,3aR,6aR)-1-(4-methylsulfonylphenyl)sulfonyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N2[C@@H](C(=O)O)C[C@H]3CCC[C@H]32)cc1 |
| InChI | InChI=1S/C15H19NO6S2/c1-23(19,20)11-5-7-12(8-6-11)24(21,22)16-13-4-2-3-10(13)9-14(16)15(17)18/h5-8,10,13-14H,2-4,9H2,1H3,(H,17,18)/t10-,13-,14-/m1/s1 |
| InChIKey | CTQKTELKTSZVNA-LERXQTSPSA-N |
| XLogP | 1.11 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |