C31H32F3N3O3 — CID 59425256
1-cyclobutyl-3-[4-[1-cyclobutyl-6-(oxan-4-yloxy)-3-(3,3,3-trifluoroprop-1-ynyl)indol-2-yl]phenyl]urea (PubChem CID 59425256) has the molecular formula C31H32F3N3O3 and a molecular weight of 551.61 g/mol. Its IUPAC name is 1-cyclobutyl-3-[4-[1-cyclobutyl-6-(oxan-4-yloxy)-3-(3,3,3-trifluoroprop-1-ynyl)indol-2-yl]phenyl]urea.
| Compound Name | 1-cyclobutyl-3-[4-[1-cyclobutyl-6-(oxan-4-yloxy)-3-(3,3,3-trifluoroprop-1-ynyl)indol-2-yl]phenyl]urea |
|---|---|
| PubChem CID | 59425256 |
| Molecular Formula | C31H32F3N3O3 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 1-cyclobutyl-3-[4-[1-cyclobutyl-6-(oxan-4-yloxy)-3-(3,3,3-trifluoroprop-1-ynyl)indol-2-yl]phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2c(C#CC(F)(F)F)c3ccc(OC4CCOCC4)cc3n2C2CCC2)cc1)NC1CCC1 |
| InChI | InChI=1S/C31H32F3N3O3/c32-31(33,34)16-13-27-26-12-11-25(40-24-14-17-39-18-15-24)19-28(26)37(23-5-2-6-23)29(27)20-7-9-22(10-8-20)36-30(38)35-21-3-1-4-21/h7-12,19,21,23-24H,1-6,14-15,17-18H2,(H2,35,36,38) |
| InChIKey | PJWLLYWTAIACRQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|