C34H33FN6O3 — CID 59425359
[(1R)-1-(4-fluorophenyl)ethyl] N-[4-[3-cyano-1-cyclobutyl-6-[4-(1,2,4-triazol-1-yl)butoxy]indol-2-yl]phenyl]carbamate (PubChem CID 59425359) has the molecular formula C34H33FN6O3 and a molecular weight of 592.68 g/mol. Its IUPAC name is [(1R)-1-(4-fluorophenyl)ethyl] N-[4-[3-cyano-1-cyclobutyl-6-[4-(1,2,4-triazol-1-yl)butoxy]indol-2-yl]phenyl]carbamate.
| Compound Name | [(1R)-1-(4-fluorophenyl)ethyl] N-[4-[3-cyano-1-cyclobutyl-6-[4-(1,2,4-triazol-1-yl)butoxy]indol-2-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 59425359 |
| Molecular Formula | C34H33FN6O3 |
| Molecular Weight | 592.68 g/mol |
| Exact Mass | 592.26 |
| IUPAC Name | [(1R)-1-(4-fluorophenyl)ethyl] N-[4-[3-cyano-1-cyclobutyl-6-[4-(1,2,4-triazol-1-yl)butoxy]indol-2-yl]phenyl]carbamate |
| SMILES | C[C@@H](OC(=O)Nc1ccc(-c2c(C#N)c3ccc(OCCCCn4cncn4)cc3n2C2CCC2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H33FN6O3/c1-23(24-7-11-26(35)12-8-24)44-34(42)39-27-13-9-25(10-14-27)33-31(20-36)30-16-15-29(19-32(30)41(33)28-5-4-6-28)43-18-3-2-17-40-22-37-21-38-40/h7-16,19,21-23,28H,2-6,17-18H2,1H3,(H,39,42)/t23-/m1/s1 |
| InChIKey | RYAGAXAWMVPTCJ-HSZRJFAPSA-N |
| XLogP | 7.80 |
| TPSA | 106.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.68 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|