C16H20O6 — CID 59426481
(1'R,3'aR,8'aS,9'aS)-1'-methyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxylic acid (PubChem CID 59426481) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is (1'R,3'aR,8'aS,9'aS)-1'-methyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxylic acid.
| Compound Name | (1'R,3'aR,8'aS,9'aS)-1'-methyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxylic acid |
|---|---|
| PubChem CID | 59426481 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (1'R,3'aR,8'aS,9'aS)-1'-methyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxylic acid |
| SMILES | C[C@H]1OC(=O)[C@@H]2C=C3CC4(CC[C@H]3C(C(=O)O)[C@H]12)OCCO4 |
| InChI | InChI=1S/C16H20O6/c1-8-12-11(15(19)22-8)6-9-7-16(20-4-5-21-16)3-2-10(9)13(12)14(17)18/h6,8,10-13H,2-5,7H2,1H3,(H,17,18)/t8-,10-,11-,12-,13?/m1/s1 |
| InChIKey | ARJSBMNGADVTBW-FLBHPLMVSA-N |
| XLogP | 1.35 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|