About [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate
[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate (PubChem CID 59426489) has the molecular formula C17H20O5
and a molecular weight of 304.34 g/mol. Its IUPAC name is [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate.
Molecular Properties
| Compound Name | [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate |
| PubChem CID | 59426489 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate |
| SMILES | CC(=O)C#C[C@@H](C)OC(=O)/C=C/C1=CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C17H20O5/c1-13(18)5-6-14(2)22-16(19)8-7-15-4-3-9-17(12-15)20-10-11-21-17/h4,7-8,14H,3,9-12H2,1-2H3/b8-7+/t14-/m1/s1 |
| InChIKey | RUGNTITWPXNNGZ-HSBSLETESA-N |
| XLogP | 1.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate?
The IUPAC name of [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate (CID 59426489) is [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate.
What is the SMILES notation for [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate?
The canonical SMILES for [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate is CC(=O)C#C[C@@H](C)OC(=O)/C=C/C1=CCCC2(C1)OCCO2.
What is the InChIKey of [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate?
The InChIKey is RUGNTITWPXNNGZ-HSBSLETESA-N. The full InChI is InChI=1S/C17H20O5/c1-13(18)5-6-14(2)22-16(19)8-7-15-4-3-9-17(12-15)20-10-11-21-17/h4,7-8,14H,3,9-12H2,1-2H3/b8-7+/t14-/m1/s1.
What are the key properties of [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate?
[(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate has a molecular weight of 304.34 g/mol, XLogP of 1.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-5-oxohex-3-yn-2-yl] (E)-3-(1,4-dioxaspiro[4.5]dec-7-en-7-yl)prop-2-enoate is sourced from PubChem (CID 59426489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).