C17H22O5 — CID 59426492
(1'R,3'aR,8'aS,9'S,9'aS)-9'-acetyl-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one (PubChem CID 59426492) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is (1'R,3'aR,8'aS,9'S,9'aS)-9'-acetyl-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one.
| Compound Name | (1'R,3'aR,8'aS,9'S,9'aS)-9'-acetyl-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 59426492 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (1'R,3'aR,8'aS,9'S,9'aS)-9'-acetyl-1'-methylspiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
| SMILES | CC(=O)[C@@H]1[C@@H]2[C@@H](C)OC(=O)[C@@H]2C=C2CC3(CC[C@H]21)OCCO3 |
| InChI | InChI=1S/C17H22O5/c1-9(18)14-12-3-4-17(20-5-6-21-17)8-11(12)7-13-15(14)10(2)22-16(13)19/h7,10,12-15H,3-6,8H2,1-2H3/t10-,12-,13-,14+,15-/m1/s1 |
| InChIKey | UCDXLQANUZJIKZ-DVLUHMITSA-N |
| XLogP | 1.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|