C20H27NO6 — CID 59426512
(3'aR,8'aS,9'S,9'aS)-1'-methyl-9'-(morpholine-4-carbonyl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one (PubChem CID 59426512) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is (3'aR,8'aS,9'S,9'aS)-1'-methyl-9'-(morpholine-4-carbonyl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one.
| Compound Name | (3'aR,8'aS,9'S,9'aS)-1'-methyl-9'-(morpholine-4-carbonyl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
|---|---|
| PubChem CID | 59426512 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (3'aR,8'aS,9'S,9'aS)-1'-methyl-9'-(morpholine-4-carbonyl)spiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-3'-one |
| SMILES | CC1OC(=O)[C@@H]2C=C3CC4(CC[C@H]3[C@H](C(=O)N3CCOCC3)[C@H]12)OCCO4 |
| InChI | InChI=1S/C20H27NO6/c1-12-16-15(19(23)27-12)10-13-11-20(25-8-9-26-20)3-2-14(13)17(16)18(22)21-4-6-24-7-5-21/h10,12,14-17H,2-9,11H2,1H3/t12?,14-,15-,16-,17+/m1/s1 |
| InChIKey | YPZUDSJMFCDWAQ-LJWMNGLYSA-N |
| XLogP | 1.12 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|