C18H25NO5 — CID 59426518
(3'aR,8'aS,9'S,9'aS)-N,N,1'-trimethyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide (PubChem CID 59426518) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is (3'aR,8'aS,9'S,9'aS)-N,N,1'-trimethyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide.
| Compound Name | (3'aR,8'aS,9'S,9'aS)-N,N,1'-trimethyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide |
|---|---|
| PubChem CID | 59426518 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | (3'aR,8'aS,9'S,9'aS)-N,N,1'-trimethyl-3'-oxospiro[1,3-dioxolane-2,6'-1,3a,5,7,8,8a,9,9a-octahydrobenzo[f][2]benzofuran]-9'-carboxamide |
| SMILES | CC1OC(=O)[C@@H]2C=C3CC4(CC[C@H]3[C@H](C(=O)N(C)C)[C@H]12)OCCO4 |
| InChI | InChI=1S/C18H25NO5/c1-10-14-13(17(21)24-10)8-11-9-18(22-6-7-23-18)5-4-12(11)15(14)16(20)19(2)3/h8,10,12-15H,4-7,9H2,1-3H3/t10?,12-,13-,14-,15+/m1/s1 |
| InChIKey | GFWVTOCBWBMHHO-OLOOJZQVSA-N |
| XLogP | 1.35 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|