About 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane
4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane (PubChem CID 59426868) has the molecular formula C12H21NNiO3
and a molecular weight of 286.00 g/mol. Its IUPAC name is 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane.
Molecular Properties
| Compound Name | 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane |
| PubChem CID | 59426868 |
| Molecular Formula | C12H21NNiO3 |
| Molecular Weight | 286.00 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane |
| SMILES | O=C=NCCC[C-]=O.[CH2-]CCCOCCC.[Ni+2] |
| InChI | InChI=1S/C7H15O.C5H6NO2.Ni/c1-3-5-7-8-6-4-2;7-4-2-1-3-6-5-8;/h1,3-7H2,2H3;1-3H2;/q2*-1;+2 |
| InChIKey | UAVAAAZRPGDBSA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.00 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane?
The IUPAC name of 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane (CID 59426868) is 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane.
What is the SMILES notation for 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane?
The canonical SMILES for 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane is O=C=NCCC[C-]=O.[CH2-]CCCOCCC.[Ni+2].
What is the InChIKey of 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane?
The InChIKey is UAVAAAZRPGDBSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O.C5H6NO2.Ni/c1-3-5-7-8-6-4-2;7-4-2-1-3-6-5-8;/h1,3-7H2,2H3;1-3H2;/q2*-1;+2.
What are the key properties of 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane?
4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane has a molecular weight of 286.00 g/mol, XLogP of 2.24, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isocyanatobutan-1-one;nickel(2+);1-propoxybutane is sourced from PubChem (CID 59426868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).