C16H16F4O4S — CID 59427025
1,1,2,2-tetrafluoro-2-[2-(1-methylnaphthalen-2-yl)propan-2-yloxy]ethanesulfonic acid (PubChem CID 59427025) has the molecular formula C16H16F4O4S and a molecular weight of 380.36 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-[2-(1-methylnaphthalen-2-yl)propan-2-yloxy]ethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-[2-(1-methylnaphthalen-2-yl)propan-2-yloxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 59427025 |
| Molecular Formula | C16H16F4O4S |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-[2-(1-methylnaphthalen-2-yl)propan-2-yloxy]ethanesulfonic acid |
| SMILES | Cc1c(C(C)(C)OC(F)(F)C(F)(F)S(=O)(=O)O)ccc2ccccc12 |
| InChI | InChI=1S/C16H16F4O4S/c1-10-12-7-5-4-6-11(12)8-9-13(10)14(2,3)24-15(17,18)16(19,20)25(21,22)23/h4-9H,1-3H3,(H,21,22,23) |
| InChIKey | UYEVDFZIHVIPAN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|