C11H13F3N2O3 — CID 59427099
N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-2,2,2-trifluoroacetamide (PubChem CID 59427099) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 59427099 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-[5-(2,5-dioxopyrrol-1-yl)pentyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1C=CC(=O)N1CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)10(19)15-6-2-1-3-7-16-8(17)4-5-9(16)18/h4-5H,1-3,6-7H2,(H,15,19) |
| InChIKey | TYDAEGNKXOBQEQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|