C15H14F3N3O4S2 — CID 59427386
[1-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 59427386) has the molecular formula C15H14F3N3O4S2 and a molecular weight of 421.42 g/mol. Its IUPAC name is [1-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [1-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59427386 |
| Molecular Formula | C15H14F3N3O4S2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [1-[(6-methyl-1,3-benzothiazol-2-yl)carbamoyl]-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | Cc1ccc2nc(NC(=O)N3CC=C(OS(=O)(=O)C(F)(F)F)CC3)sc2c1 |
| InChI | InChI=1S/C15H14F3N3O4S2/c1-9-2-3-11-12(8-9)26-13(19-11)20-14(22)21-6-4-10(5-7-21)25-27(23,24)15(16,17)18/h2-4,8H,5-7H2,1H3,(H,19,20,22) |
| InChIKey | ISTVDOYAUNGPSD-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|