C24H31Cl2FN6O — CID 59427698
5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyridine-3-carbohydrazide (PubChem CID 59427698) has the molecular formula C24H31Cl2FN6O and a molecular weight of 509.46 g/mol. Its IUPAC name is 5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyridine-3-carbohydrazide.
| Compound Name | 5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 59427698 |
| Molecular Formula | C24H31Cl2FN6O |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 5-chloro-6-[(3S)-4-[1-[(4-chloro-2-fluorophenyl)methyl]piperidin-4-yl]-3-ethylpiperazin-1-yl]pyridine-3-carbohydrazide |
| SMILES | CC[C@H]1CN(c2ncc(C(=O)NN)cc2Cl)CCN1C1CCN(Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C24H31Cl2FN6O/c1-2-19-15-32(23-21(26)11-17(13-29-23)24(34)30-28)9-10-33(19)20-5-7-31(8-6-20)14-16-3-4-18(25)12-22(16)27/h3-4,11-13,19-20H,2,5-10,14-15,28H2,1H3,(H,30,34)/t19-/m0/s1 |
| InChIKey | YPFXAJNTZKILFT-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|