C36H57N7O4SSi2 — CID 59427806
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-methylpyrazol-4-yl)-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 59427806) has the molecular formula C36H57N7O4SSi2 and a molecular weight of 740.14 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-methylpyrazol-4-yl)-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-methylpyrazol-4-yl)-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59427806 |
| Molecular Formula | C36H57N7O4SSi2 |
| Molecular Weight | 740.14 g/mol |
| Exact Mass | 739.37 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(1-methylpyrazol-4-yl)-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | Cn1cc(-c2cnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c(-c4cccs4)c(C4CCCN(C(=O)OC(C)(C)C)C4)nc23)cn1 |
| InChI | InChI=1S/C36H57N7O4SSi2/c1-36(2,3)47-35(44)41-15-11-13-27(24-41)32-31(30-14-12-18-48-30)34(43-33(39-32)29(22-38-43)28-21-37-40(4)23-28)42(25-45-16-19-49(5,6)7)26-46-17-20-50(8,9)10/h12,14,18,21-23,27H,11,13,15-17,19-20,24-26H2,1-10H3 |
| InChIKey | QQSAPVWVJAYIFK-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 99.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.14 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|