C32H53N5O4SSi2 — CID 59427814
tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate (PubChem CID 59427814) has the molecular formula C32H53N5O4SSi2 and a molecular weight of 660.05 g/mol. Its IUPAC name is tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59427814 |
| Molecular Formula | C32H53N5O4SSi2 |
| Molecular Weight | 660.05 g/mol |
| Exact Mass | 659.34 |
| IUPAC Name | tert-butyl 3-[7-[bis(2-trimethylsilylethoxymethyl)amino]-6-thiophen-2-ylpyrazolo[1,5-a]pyrimidin-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2nc3ccnn3c(N(COCC[Si](C)(C)C)COCC[Si](C)(C)C)c2-c2cccs2)C1 |
| InChI | InChI=1S/C32H53N5O4SSi2/c1-32(2,3)41-31(38)35-16-10-12-25(22-35)29-28(26-13-11-19-42-26)30(37-27(34-29)14-15-33-37)36(23-39-17-20-43(4,5)6)24-40-18-21-44(7,8)9/h11,13-15,19,25H,10,12,16-18,20-24H2,1-9H3 |
| InChIKey | KKQJYNHKCLEYAH-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.05 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|