C8H10Cl3NO2 — CID 59428108
(3R,7aS)-7a-methyl-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one (PubChem CID 59428108) has the molecular formula C8H10Cl3NO2 and a molecular weight of 258.53 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one.
| Compound Name | (3R,7aS)-7a-methyl-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
|---|---|
| PubChem CID | 59428108 |
| Molecular Formula | C8H10Cl3NO2 |
| Molecular Weight | 258.53 g/mol |
| Exact Mass | 256.98 |
| IUPAC Name | (3R,7aS)-7a-methyl-3-(trichloromethyl)-3,5,6,7-tetrahydropyrrolo[1,2-c][1,3]oxazol-1-one |
| SMILES | C[C@@]12CCCN1[C@@H](C(Cl)(Cl)Cl)OC2=O |
| InChI | InChI=1S/C8H10Cl3NO2/c1-7-3-2-4-12(7)5(8(9,10)11)14-6(7)13/h5H,2-4H2,1H3/t5-,7+/m1/s1 |
| InChIKey | CQNBNGSUEQTECE-VDTYLAMSSA-N |
| XLogP | 2.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.53 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|