C87H58N4O — CID 59428689
[4-[3,5-bis[6-(2,6-diphenyl-4-pyridinyl)-2,4-diphenyl-3-pyridinyl]phenyl]phenyl]-phenylmethanone (PubChem CID 59428689) has the molecular formula C87H58N4O and a molecular weight of 1175.45 g/mol. Its IUPAC name is [4-[3,5-bis[6-(2,6-diphenyl-4-pyridinyl)-2,4-diphenyl-3-pyridinyl]phenyl]phenyl]-phenylmethanone.
| Compound Name | [4-[3,5-bis[6-(2,6-diphenyl-4-pyridinyl)-2,4-diphenyl-3-pyridinyl]phenyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 59428689 |
| Molecular Formula | C87H58N4O |
| Molecular Weight | 1175.45 g/mol |
| Exact Mass | 1174.46 |
| IUPAC Name | [4-[3,5-bis[6-(2,6-diphenyl-4-pyridinyl)-2,4-diphenyl-3-pyridinyl]phenyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(-c2cc(-c3c(-c4ccccc4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)nc3-c3ccccc3)cc(-c3c(-c4ccccc4)cc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)nc3-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C87H58N4O/c92-87(68-44-26-9-27-45-68)69-48-46-59(47-49-69)70-50-73(83-75(60-28-10-1-11-29-60)57-81(90-85(83)66-40-22-7-23-41-66)71-53-77(62-32-14-3-15-33-62)88-78(54-71)63-34-16-4-17-35-63)52-74(51-70)84-76(61-30-12-2-13-31-61)58-82(91-86(84)67-42-24-8-25-43-67)72-55-79(64-36-18-5-19-37-64)89-80(56-72)65-38-20-6-21-39-65/h1-58H |
| InChIKey | YVDBOZRVONQMBY-UHFFFAOYSA-N |
| XLogP | 22.17 |
| TPSA | 68.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1175.45 |
| LogP ≤ 5 | 22.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |