About dichloroplatinum;bis(morpholine-4-carbonitrile)
dichloroplatinum;bis(morpholine-4-carbonitrile) (PubChem CID 59428779) has the molecular formula C10H16Cl2N4O2Pt
and a molecular weight of 490.25 g/mol. Its IUPAC name is dichloroplatinum;bis(morpholine-4-carbonitrile).
Molecular Properties
| Compound Name | dichloroplatinum;bis(morpholine-4-carbonitrile) |
| PubChem CID | 59428779 |
| Molecular Formula | C10H16Cl2N4O2Pt |
| Molecular Weight | 490.25 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | dichloroplatinum;bis(morpholine-4-carbonitrile) |
| SMILES | Cl[Pt]Cl.N#CN1CCOCC1.N#CN1CCOCC1 |
| InChI | InChI=1S/2C5H8N2O.2ClH.Pt/c2*6-5-7-1-3-8-4-2-7;;;/h2*1-4H2;2*1H;/q;;;;+2/p-2 |
| InChIKey | UIXFRPFBEILFTA-UHFFFAOYSA-L |
| XLogP | 0.98 |
| TPSA | 72.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze dichloroplatinum;bis(morpholine-4-carbonitrile) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloroplatinum;bis(morpholine-4-carbonitrile)?
The IUPAC name of dichloroplatinum;bis(morpholine-4-carbonitrile) (CID 59428779) is dichloroplatinum;bis(morpholine-4-carbonitrile).
What is the SMILES notation for dichloroplatinum;bis(morpholine-4-carbonitrile)?
The canonical SMILES for dichloroplatinum;bis(morpholine-4-carbonitrile) is Cl[Pt]Cl.N#CN1CCOCC1.N#CN1CCOCC1.
What is the InChIKey of dichloroplatinum;bis(morpholine-4-carbonitrile)?
The InChIKey is UIXFRPFBEILFTA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H8N2O.2ClH.Pt/c2*6-5-7-1-3-8-4-2-7;;;/h2*1-4H2;2*1H;/q;;;;+2/p-2.
What are the key properties of dichloroplatinum;bis(morpholine-4-carbonitrile)?
dichloroplatinum;bis(morpholine-4-carbonitrile) has a molecular weight of 490.25 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dichloroplatinum;bis(morpholine-4-carbonitrile) is sourced from PubChem (CID 59428779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).