C50H73O3PS5 — CID 59428860
[3-hexyl-5-[3-hexyl-5-[3-hexyl-5-[3-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]phosphonic acid (PubChem CID 59428860) has the molecular formula C50H73O3PS5 and a molecular weight of 913.44 g/mol. Its IUPAC name is [3-hexyl-5-[3-hexyl-5-[3-hexyl-5-[3-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]phosphonic acid.
| Compound Name | [3-hexyl-5-[3-hexyl-5-[3-hexyl-5-[3-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 59428860 |
| Molecular Formula | C50H73O3PS5 |
| Molecular Weight | 913.44 g/mol |
| Exact Mass | 912.39 |
| IUPAC Name | [3-hexyl-5-[3-hexyl-5-[3-hexyl-5-[3-hexyl-5-(3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]phosphonic acid |
| SMILES | CCCCCCc1ccsc1-c1cc(CCCCCC)c(-c2cc(CCCCCC)c(-c3cc(CCCCCC)c(-c4cc(CCCCCC)c(P(=O)(O)O)s4)s3)s2)s1 |
| InChI | InChI=1S/C50H73O3PS5/c1-6-11-16-21-26-37-31-32-55-46(37)42-33-38(27-22-17-12-7-2)47(56-42)43-34-39(28-23-18-13-8-3)48(57-43)44-35-40(29-24-19-14-9-4)49(58-44)45-36-41(30-25-20-15-10-5)50(59-45)54(51,52)53/h31-36H,6-30H2,1-5H3,(H2,51,52,53) |
| InChIKey | QHZQYERLGRLRKB-UHFFFAOYSA-N |
| XLogP | 18.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.44 |
| LogP ≤ 5 | 18.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|