About 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole
4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole (PubChem CID 59430202) has the molecular formula C17H16FN3O3
and a molecular weight of 329.33 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole.
Molecular Properties
| Compound Name | 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole |
| PubChem CID | 59430202 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole |
| SMILES | COc1cc(OC)c(-c2n[nH]nc2-c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C17H16FN3O3/c1-22-13-9-15(24-3)14(23-2)8-12(13)17-16(19-21-20-17)10-4-6-11(18)7-5-10/h4-9H,1-3H3,(H,19,20,21) |
| InChIKey | SZDORQADZONQBT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole?
The IUPAC name of 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole (CID 59430202) is 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole.
What is the SMILES notation for 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole?
The canonical SMILES for 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole is COc1cc(OC)c(-c2n[nH]nc2-c2ccc(F)cc2)cc1OC.
What is the InChIKey of 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole?
The InChIKey is SZDORQADZONQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O3/c1-22-13-9-15(24-3)14(23-2)8-12(13)17-16(19-21-20-17)10-4-6-11(18)7-5-10/h4-9H,1-3H3,(H,19,20,21).
What are the key properties of 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole?
4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole has a molecular weight of 329.33 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-fluorophenyl)-5-(2,4,5-trimethoxyphenyl)-2H-triazole is sourced from PubChem (CID 59430202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).