About 1,3-dimethylpyrrolo[2,3-c]pyridine
1,3-dimethylpyrrolo[2,3-c]pyridine (PubChem CID 59430828) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 1,3-dimethylpyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 1,3-dimethylpyrrolo[2,3-c]pyridine |
| PubChem CID | 59430828 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 1,3-dimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1cn(C)c2cnccc12 |
| InChI | InChI=1S/C9H10N2/c1-7-6-11(2)9-5-10-4-3-8(7)9/h3-6H,1-2H3 |
| InChIKey | PAPAEYBOPWRFGP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-dimethylpyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrrolo[2,3-c]pyridine?
The IUPAC name of 1,3-dimethylpyrrolo[2,3-c]pyridine (CID 59430828) is 1,3-dimethylpyrrolo[2,3-c]pyridine.
What is the SMILES notation for 1,3-dimethylpyrrolo[2,3-c]pyridine?
The canonical SMILES for 1,3-dimethylpyrrolo[2,3-c]pyridine is Cc1cn(C)c2cnccc12.
What is the InChIKey of 1,3-dimethylpyrrolo[2,3-c]pyridine?
The InChIKey is PAPAEYBOPWRFGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-7-6-11(2)9-5-10-4-3-8(7)9/h3-6H,1-2H3.
What are the key properties of 1,3-dimethylpyrrolo[2,3-c]pyridine?
1,3-dimethylpyrrolo[2,3-c]pyridine has a molecular weight of 146.19 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrrolo[2,3-c]pyridine is sourced from PubChem (CID 59430828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).