C55H54N2O3Si — CID 59431032
N-[4-[4-(4-ethenyl-N-naphthalen-1-ylanilino)phenyl]phenyl]-N-[4-(3-triethoxysilylpropyl)phenyl]naphthalen-1-amine (PubChem CID 59431032) has the molecular formula C55H54N2O3Si and a molecular weight of 819.13 g/mol. Its IUPAC name is N-[4-[4-(4-ethenyl-N-naphthalen-1-ylanilino)phenyl]phenyl]-N-[4-(3-triethoxysilylpropyl)phenyl]naphthalen-1-amine.
| Compound Name | N-[4-[4-(4-ethenyl-N-naphthalen-1-ylanilino)phenyl]phenyl]-N-[4-(3-triethoxysilylpropyl)phenyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 59431032 |
| Molecular Formula | C55H54N2O3Si |
| Molecular Weight | 819.13 g/mol |
| Exact Mass | 818.39 |
| IUPAC Name | N-[4-[4-(4-ethenyl-N-naphthalen-1-ylanilino)phenyl]phenyl]-N-[4-(3-triethoxysilylpropyl)phenyl]naphthalen-1-amine |
| SMILES | C=Cc1ccc(N(c2ccc(-c3ccc(N(c4ccc(CCC[Si](OCC)(OCC)OCC)cc4)c4cccc5ccccc45)cc3)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C55H54N2O3Si/c1-5-42-25-33-48(34-26-42)56(54-23-13-19-46-17-9-11-21-52(46)54)50-37-29-44(30-38-50)45-31-39-51(40-32-45)57(55-24-14-20-47-18-10-12-22-53(47)55)49-35-27-43(28-36-49)16-15-41-61(58-6-2,59-7-3)60-8-4/h5,9-14,17-40H,1,6-8,15-16,41H2,2-4H3 |
| InChIKey | MAIYGJKXCHDIJH-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.13 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|