About 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane
5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane (PubChem CID 59431297) has the molecular formula C10H10F6O
and a molecular weight of 260.18 g/mol. Its IUPAC name is 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane.
Molecular Properties
| Compound Name | 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
| PubChem CID | 59431297 |
| Molecular Formula | C10H10F6O |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
| SMILES | FC(F)(F)C1(C(F)(F)F)OC2CC3CC2C1C3 |
| InChI | InChI=1S/C10H10F6O/c11-9(12,13)8(10(14,15)16)6-2-4-1-5(6)7(3-4)17-8/h4-7H,1-3H2 |
| InChIKey | PLGVMYFGNUPASC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane (CID 59431297) is 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane is FC(F)(F)C1(C(F)(F)F)OC2CC3CC2C1C3.
What is the InChIKey of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The InChIKey is PLGVMYFGNUPASC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F6O/c11-9(12,13)8(10(14,15)16)6-2-4-1-5(6)7(3-4)17-8/h4-7H,1-3H2.
What are the key properties of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane has a molecular weight of 260.18 g/mol, XLogP of 3.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 59431297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).