About 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane
9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane (PubChem CID 59431300) has the molecular formula C12H12F6O2
and a molecular weight of 302.21 g/mol. Its IUPAC name is 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane.
Molecular Properties
| Compound Name | 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
| PubChem CID | 59431300 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
| SMILES | C=COC1C2CC3OC(C(F)(F)F)(C(F)(F)F)C1C3C2 |
| InChI | InChI=1S/C12H12F6O2/c1-2-19-9-5-3-6-7(4-5)20-10(8(6)9,11(13,14)15)12(16,17)18/h2,5-9H,1,3-4H2 |
| InChIKey | IRQGEBQKRVEDGS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The IUPAC name of 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane (CID 59431300) is 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane.
What is the SMILES notation for 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The canonical SMILES for 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane is C=COC1C2CC3OC(C(F)(F)F)(C(F)(F)F)C1C3C2.
What is the InChIKey of 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
The InChIKey is IRQGEBQKRVEDGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F6O2/c1-2-19-9-5-3-6-7(4-5)20-10(8(6)9,11(13,14)15)12(16,17)18/h2,5-9H,1,3-4H2.
What are the key properties of 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane?
9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane has a molecular weight of 302.21 g/mol, XLogP of 3.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane is sourced from PubChem (CID 59431300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).