C12H12F6O2 — CID 59431302
(1R,7S)-9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane (PubChem CID 59431302) has the molecular formula C12H12F6O2 and a molecular weight of 302.21 g/mol. Its IUPAC name is (1R,7S)-9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane.
| Compound Name | (1R,7S)-9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
|---|---|
| PubChem CID | 59431302 |
| Molecular Formula | C12H12F6O2 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (1R,7S)-9-ethenoxy-5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonane |
| SMILES | C=COC1C2[C@@H]3C[C@@H]1CC3OC2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H12F6O2/c1-2-19-9-5-3-6-7(4-5)20-10(8(6)9,11(13,14)15)12(16,17)18/h2,5-9H,1,3-4H2/t5-,6-,7?,8?,9?/m1/s1 |
| InChIKey | IRQGEBQKRVEDGS-KUUBJVQQSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|