About 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol
5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol (PubChem CID 59431304) has the molecular formula C10H10F6O2
and a molecular weight of 276.18 g/mol. Its IUPAC name is 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol.
Molecular Properties
| Compound Name | 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol |
| PubChem CID | 59431304 |
| Molecular Formula | C10H10F6O2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol |
| SMILES | OC1C2CC3OC(C(F)(F)F)(C(F)(F)F)C1C3C2 |
| InChI | InChI=1S/C10H10F6O2/c11-9(12,13)8(10(14,15)16)6-4-1-3(7(6)17)2-5(4)18-8/h3-7,17H,1-2H2 |
| InChIKey | CTCVKANQVLMBBW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol?
The IUPAC name of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol (CID 59431304) is 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol.
What is the SMILES notation for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol?
The canonical SMILES for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol is OC1C2CC3OC(C(F)(F)F)(C(F)(F)F)C1C3C2.
What is the InChIKey of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol?
The InChIKey is CTCVKANQVLMBBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F6O2/c11-9(12,13)8(10(14,15)16)6-4-1-3(7(6)17)2-5(4)18-8/h3-7,17H,1-2H2.
What are the key properties of 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol?
5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol has a molecular weight of 276.18 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-bis(trifluoromethyl)-4-oxatricyclo[4.2.1.03,7]nonan-9-ol is sourced from PubChem (CID 59431304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).