C18H11F5IrN2O-2 — CID 59431396
2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;1-[3-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone (PubChem CID 59431396) has the molecular formula C18H11F5IrN2O-2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;1-[3-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone.
| Compound Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;1-[3-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
|---|---|
| PubChem CID | 59431396 |
| Molecular Formula | C18H11F5IrN2O-2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | 2-(2,4-difluorobenzene-6-id-1-yl)pyridine;iridium;1-[3-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
| SMILES | CC(=O)c1[n-]ccc1C(F)(F)F.Fc1c[c-]c(-c2ccccn2)c(F)c1.[Ir] |
| InChI | InChI=1S/C11H6F2N.C7H6F3NO.Ir/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11;1-4(12)6-5(2-3-11-6)7(8,9)10;/h1-4,6-7H;2-3H,1H3,(H,11,12);/q-1;;/p-1 |
| InChIKey | HUUMFRAQEXAGRW-UHFFFAOYSA-M |
| XLogP | 4.69 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|