C20H11F9IrN2O-2 — CID 59431401
2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone (PubChem CID 59431401) has the molecular formula C20H11F9IrN2O-2 and a molecular weight of 658.52 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
|---|---|
| PubChem CID | 59431401 |
| Molecular Formula | C20H11F9IrN2O-2 |
| Molecular Weight | 658.52 g/mol |
| Exact Mass | 659.04 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)benzene-6-id-1-yl]pyridine;iridium;1-[4-(trifluoromethyl)pyrrol-1-id-2-yl]ethanone |
| SMILES | CC(=O)c1cc(C(F)(F)F)c[n-]1.FC(F)(F)c1[c-]c(-c2ccccn2)cc(C(F)(F)F)c1.[Ir] |
| InChI | InChI=1S/C13H6F6N.C7H6F3NO.Ir/c14-12(15,16)9-5-8(11-3-1-2-4-20-11)6-10(7-9)13(17,18)19;1-4(12)6-2-5(3-11-6)7(8,9)10;/h1-5,7H;2-3H,1H3,(H,11,12);/q-1;;/p-1 |
| InChIKey | JTQOAOKEBSYNSN-UHFFFAOYSA-M |
| XLogP | 6.45 |
| TPSA | 44.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|