C10H10F10 — CID 59431492
4-(1,1-difluoro-2-methylpropyl)-1,1,2,2,3,3,5,5-octafluorocyclohexane (PubChem CID 59431492) has the molecular formula C10H10F10 and a molecular weight of 320.17 g/mol. Its IUPAC name is 4-(1,1-difluoro-2-methylpropyl)-1,1,2,2,3,3,5,5-octafluorocyclohexane.
| Compound Name | 4-(1,1-difluoro-2-methylpropyl)-1,1,2,2,3,3,5,5-octafluorocyclohexane |
|---|---|
| PubChem CID | 59431492 |
| Molecular Formula | C10H10F10 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-(1,1-difluoro-2-methylpropyl)-1,1,2,2,3,3,5,5-octafluorocyclohexane |
| SMILES | CC(C)C(F)(F)C1C(F)(F)CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H10F10/c1-4(2)8(15,16)5-6(11,12)3-7(13,14)10(19,20)9(5,17)18/h4-5H,3H2,1-2H3 |
| InChIKey | MRINOZKNCHGQCS-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|