About CID 59432259
CID 59432259 (PubChem CID 59432259) has the molecular formula C22H32N3O
and a molecular weight of 354.52 g/mol.
Molecular Properties
| Compound Name | CID 59432259 |
| PubChem CID | 59432259 |
| Molecular Formula | C22H32N3O |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | — |
| SMILES | [NH]C(=O)N1CCCC2(CCN(CC3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H32N3O/c23-21(26)25-14-6-11-22(19-9-4-5-10-20(19)25)12-15-24(16-13-22)17-18-7-2-1-3-8-18/h4-5,9-10,18,23H,1-3,6-8,11-17H2 |
| InChIKey | HKDHCWDHPRXGKM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 47.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59432259 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59432259?
The IUPAC name of CID 59432259 (CID 59432259) is not available.
What is the SMILES notation for CID 59432259?
The canonical SMILES for CID 59432259 is [NH]C(=O)N1CCCC2(CCN(CC3CCCCC3)CC2)c2ccccc21.
What is the InChIKey of CID 59432259?
The InChIKey is HKDHCWDHPRXGKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N3O/c23-21(26)25-14-6-11-22(19-9-4-5-10-20(19)25)12-15-24(16-13-22)17-18-7-2-1-3-8-18/h4-5,9-10,18,23H,1-3,6-8,11-17H2.
What are the key properties of CID 59432259?
CID 59432259 has a molecular weight of 354.52 g/mol, XLogP of 4.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59432259 is sourced from PubChem (CID 59432259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).