About 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide
3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide (PubChem CID 59432547) has the molecular formula C20H18F2N2O2S
and a molecular weight of 388.44 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide |
| PubChem CID | 59432547 |
| Molecular Formula | C20H18F2N2O2S |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide |
| SMILES | COCC(C)NC(=O)c1cc(-c2cncs2)cc(-c2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C20H18F2N2O2S/c1-12(10-26-2)24-20(25)15-6-13(17-4-3-16(21)8-18(17)22)5-14(7-15)19-9-23-11-27-19/h3-9,11-12H,10H2,1-2H3,(H,24,25) |
| InChIKey | OKVXJJWCNMWFGF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide?
The IUPAC name of 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide (CID 59432547) is 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide.
What is the SMILES notation for 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide?
The canonical SMILES for 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide is COCC(C)NC(=O)c1cc(-c2cncs2)cc(-c2ccc(F)cc2F)c1.
What is the InChIKey of 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide?
The InChIKey is OKVXJJWCNMWFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F2N2O2S/c1-12(10-26-2)24-20(25)15-6-13(17-4-3-16(21)8-18(17)22)5-14(7-15)19-9-23-11-27-19/h3-9,11-12H,10H2,1-2H3,(H,24,25).
What are the key properties of 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide?
3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide has a molecular weight of 388.44 g/mol, XLogP of 4.52, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-difluorophenyl)-N-(1-methoxypropan-2-yl)-5-(1,3-thiazol-5-yl)benzamide is sourced from PubChem (CID 59432547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).