About N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide
N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide (PubChem CID 59432548) has the molecular formula C21H22N2O3
and a molecular weight of 350.42 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide |
| PubChem CID | 59432548 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide |
| SMILES | COCC(C)NC(=O)c1cc(-c2ccc(C)cc2)cc(-c2ccno2)c1 |
| InChI | InChI=1S/C21H22N2O3/c1-14-4-6-16(7-5-14)17-10-18(20-8-9-22-26-20)12-19(11-17)21(24)23-15(2)13-25-3/h4-12,15H,13H2,1-3H3,(H,23,24) |
| InChIKey | RBDURVWEFYGQPG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide?
The IUPAC name of N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide (CID 59432548) is N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide?
The canonical SMILES for N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide is COCC(C)NC(=O)c1cc(-c2ccc(C)cc2)cc(-c2ccno2)c1.
What is the InChIKey of N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide?
The InChIKey is RBDURVWEFYGQPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O3/c1-14-4-6-16(7-5-14)17-10-18(20-8-9-22-26-20)12-19(11-17)21(24)23-15(2)13-25-3/h4-12,15H,13H2,1-3H3,(H,23,24).
What are the key properties of N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide?
N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide has a molecular weight of 350.42 g/mol, XLogP of 4.08, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-methoxypropan-2-yl)-3-(4-methylphenyl)-5-(1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 59432548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).