About 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline
2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline (PubChem CID 59432750) has the molecular formula C19H22N4
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline.
Molecular Properties
| Compound Name | 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline |
| PubChem CID | 59432750 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline |
| SMILES | C=C1CCC(c2ccc(-c3ccncc3)cc2NC(C)C)=NN1 |
| InChI | InChI=1S/C19H22N4/c1-13(2)21-19-12-16(15-8-10-20-11-9-15)5-6-17(19)18-7-4-14(3)22-23-18/h5-6,8-13,21-22H,3-4,7H2,1-2H3 |
| InChIKey | MQDCLQWEHZKTQF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline?
The IUPAC name of 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline (CID 59432750) is 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline.
What is the SMILES notation for 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline?
The canonical SMILES for 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline is C=C1CCC(c2ccc(-c3ccncc3)cc2NC(C)C)=NN1.
What is the InChIKey of 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline?
The InChIKey is MQDCLQWEHZKTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4/c1-13(2)21-19-12-16(15-8-10-20-11-9-15)5-6-17(19)18-7-4-14(3)22-23-18/h5-6,8-13,21-22H,3-4,7H2,1-2H3.
What are the key properties of 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline?
2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline has a molecular weight of 306.41 g/mol, XLogP of 4.17, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylidene-4,5-dihydro-1H-pyridazin-3-yl)-N-propan-2-yl-5-pyridin-4-ylaniline is sourced from PubChem (CID 59432750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).