C24H31N3O3 — CID 59433152
but-2-ynyl (3R)-3-[(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]pyrrolidine-1-carboxylate (PubChem CID 59433152) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is but-2-ynyl (3R)-3-[(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]pyrrolidine-1-carboxylate.
| Compound Name | but-2-ynyl (3R)-3-[(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59433152 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | but-2-ynyl (3R)-3-[(1-acetylspiro[2H-indole-3,4'-piperidine]-1'-yl)methyl]pyrrolidine-1-carboxylate |
| SMILES | CC#CCOC(=O)N1CC[C@H](CN2CCC3(CC2)CN(C(C)=O)c2ccccc23)C1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-4-15-30-23(29)26-12-9-20(17-26)16-25-13-10-24(11-14-25)18-27(19(2)28)22-8-6-5-7-21(22)24/h5-8,20H,9-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | JYABEDUFHZEJGX-HXUWFJFHSA-N |
| XLogP | 2.87 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|