About (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate
(2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate (PubChem CID 59434220) has the molecular formula C14H21N3O6
and a molecular weight of 327.34 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate |
| PubChem CID | 59434220 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H21N3O6/c1-9(18)15-8-4-3-5-11(16-10(2)19)14(22)23-17-12(20)6-7-13(17)21/h11H,3-8H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | LATUYRINCRWMKQ-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate (CID 59434220) is (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate is CC(=O)NCCCCC(NC(C)=O)C(=O)ON1C(=O)CCC1=O.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate?
The InChIKey is LATUYRINCRWMKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O6/c1-9(18)15-8-4-3-5-11(16-10(2)19)14(22)23-17-12(20)6-7-13(17)21/h11H,3-8H2,1-2H3,(H,15,18)(H,16,19).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate?
(2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate has a molecular weight of 327.34 g/mol, XLogP of -0.60, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2,6-diacetamidohexanoate is sourced from PubChem (CID 59434220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).