About 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide
5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide (PubChem CID 59434856) has the molecular formula C15H17N7O2
and a molecular weight of 327.35 g/mol. Its IUPAC name is 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide |
| PubChem CID | 59434856 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)c2nc(N)c(C(C)=O)nc2N)cc1 |
| InChI | InChI=1S/C15H17N7O2/c1-7(23)10-13(18)22-11(14(19)21-10)15(24)20-6-8-2-4-9(5-3-8)12(16)17/h2-5H,6H2,1H3,(H3,16,17)(H2,18,22)(H2,19,21)(H,20,24) |
| InChIKey | TVWABAJWIAJJAE-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 173.86 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide?
The IUPAC name of 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide (CID 59434856) is 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide.
What is the SMILES notation for 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide?
The canonical SMILES for 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide is [H]/N=C(\N)c1ccc(CNC(=O)c2nc(N)c(C(C)=O)nc2N)cc1.
What is the InChIKey of 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide?
The InChIKey is TVWABAJWIAJJAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N7O2/c1-7(23)10-13(18)22-11(14(19)21-10)15(24)20-6-8-2-4-9(5-3-8)12(16)17/h2-5H,6H2,1H3,(H3,16,17)(H2,18,22)(H2,19,21)(H,20,24).
What are the key properties of 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide?
5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide has a molecular weight of 327.35 g/mol, XLogP of 0.06, 5 rotatable bonds, 5 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-acetyl-3,6-diamino-N-[(4-carbamimidoylphenyl)methyl]pyrazine-2-carboxamide is sourced from PubChem (CID 59434856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).